PALMITIC ACID (7,7,8,8-D4, 98%)
0.1 G
| Chemical purity | 98% |
| Reference | DLM-2893-0.1 |
| Unlabeled CAS Number | 57-10-3 |
| Labeled CAS Number | |
| Linear formula | CH3(CH2)7(CD2)2(CH2)5COOH |
| Manufacturer | Cambridge Isotope Laboratories |
| Product Name | Item Number | Unit | Chemical purity | Linear formula | Price (excl. VAT) | Qty | |
|---|---|---|---|---|---|---|---|
| PALMITIC ACID (7,7,8,8-D4, 98%) | DLM-2893-0.5 | 0.5 G | 98% | CH3(CH2)7(CD2)2(CH2)5COOH | 752,20 € |
Add to my cart | |
| PALMITIC ACID (7,7,8,8-D4, 98%) | DLM-2893-PK | G | 98% | CH3(CH2)7(CD2)2(CH2)5COOH | Request For Quote |
Add to my cart |
