L-LYSINE:2HCL UNLABELED
G
| Chemical purity | 98% |
| Reference | ULM-8766-PK |
| Unlabeled CAS Number | |
| Labeled CAS Number | |
| Linear formula | NH2(CH2)4CH(NH2)COOH.2HCl |
| MW | 219,11 |
| Product Name | Item Number | Unit | Chemical purity | Linear formula | Price (excl. VAT) | Qty | |
|---|---|---|---|---|---|---|---|
| L-LYSINE:2HCL UNLABELED | ULM-8766-0.05 | 0.05 G | 98% | NH2(CH2)4CH(NH2)COOH.2HCl | Request For Quote |
Add to my cart | |
| L-LYSINE:2HCL UNLABELED | ULM-8766-0.1 | 0.1 G | 98% | NH2(CH2)4CH(NH2)COOH.2HCl | 90,10 € |
Add to my cart | |
| L-LYSINE:2HCL UNLABELED | ULM-8766-0.1MG | 0.1 MG | 98% | NH2(CH2)4CH(NH2)COOH·2HCl | 110,40 € |
Add to my cart |
